C24H23F5N2O3 — CID 19387246
2-[3-[(2-hydroxyethylamino)methyl]-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]-3H-isoindol-1-one (PubChem CID 19387246) has the molecular formula C24H23F5N2O3 and a molecular weight of 482.45 g/mol. Its IUPAC name is 2-[3-[(2-hydroxyethylamino)methyl]-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]-3H-isoindol-1-one.
| Compound Name | 2-[3-[(2-hydroxyethylamino)methyl]-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 19387246 |
| Molecular Formula | C24H23F5N2O3 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 2-[3-[(2-hydroxyethylamino)methyl]-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]-3H-isoindol-1-one |
| SMILES | CC1(C)Oc2ccc(C(F)(F)C(F)(F)F)cc2C(N2Cc3ccccc3C2=O)=C1CNCCO |
| InChI | InChI=1S/C24H23F5N2O3/c1-22(2)18(12-30-9-10-32)20(31-13-14-5-3-4-6-16(14)21(31)33)17-11-15(7-8-19(17)34-22)23(25,26)24(27,28)29/h3-8,11,30,32H,9-10,12-13H2,1-2H3 |
| InChIKey | CLTBHBFPKSRRHS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|