C20H17F6NO3 — CID 10812671
4-fluoro-N-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydrochromen-4-yl]benzamide (PubChem CID 10812671) has the molecular formula C20H17F6NO3 and a molecular weight of 433.35 g/mol. Its IUPAC name is 4-fluoro-N-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydrochromen-4-yl]benzamide.
| Compound Name | 4-fluoro-N-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydrochromen-4-yl]benzamide |
|---|---|
| PubChem CID | 10812671 |
| Molecular Formula | C20H17F6NO3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | 4-fluoro-N-[(3R,4S)-3-hydroxy-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-3,4-dihydrochromen-4-yl]benzamide |
| SMILES | CC1(C)Oc2ccc(C(F)(F)C(F)(F)F)cc2[C@H](NC(=O)c2ccc(F)cc2)[C@H]1O |
| InChI | InChI=1S/C20H17F6NO3/c1-18(2)16(28)15(27-17(29)10-3-6-12(21)7-4-10)13-9-11(5-8-14(13)30-18)19(22,23)20(24,25)26/h3-9,15-16,28H,1-2H3,(H,27,29)/t15-,16+/m0/s1 |
| InChIKey | CLMSNNJYGHOESW-JKSUJKDBSA-N |
| XLogP | 4.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|