C20H19F5N2O3 — CID 19386931
1-[3-[[hydroxy(methyl)amino]methyl]-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]pyridin-2-one (PubChem CID 19386931) has the molecular formula C20H19F5N2O3 and a molecular weight of 430.37 g/mol. Its IUPAC name is 1-[3-[[hydroxy(methyl)amino]methyl]-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]pyridin-2-one.
| Compound Name | 1-[3-[[hydroxy(methyl)amino]methyl]-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]pyridin-2-one |
|---|---|
| PubChem CID | 19386931 |
| Molecular Formula | C20H19F5N2O3 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[3-[[hydroxy(methyl)amino]methyl]-2,2-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)chromen-4-yl]pyridin-2-one |
| SMILES | CN(O)CC1=C(n2ccccc2=O)c2cc(C(F)(F)C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C20H19F5N2O3/c1-18(2)14(11-26(3)29)17(27-9-5-4-6-16(27)28)13-10-12(7-8-15(13)30-18)19(21,22)20(23,24)25/h4-10,29H,11H2,1-3H3 |
| InChIKey | ZRDVWDOTIFCRBI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|