C22H22F5N3O3 — CID 19387245
1-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]-3-ethylurea (PubChem CID 19387245) has the molecular formula C22H22F5N3O3 and a molecular weight of 471.43 g/mol. Its IUPAC name is 1-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]-3-ethylurea.
| Compound Name | 1-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]-3-ethylurea |
|---|---|
| PubChem CID | 19387245 |
| Molecular Formula | C22H22F5N3O3 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 1-[[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]methyl]-3-ethylurea |
| SMILES | CCNC(=O)NCC1=C(n2ccccc2=O)c2cc(C(F)(F)C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C22H22F5N3O3/c1-4-28-19(32)29-12-15-18(30-10-6-5-7-17(30)31)14-11-13(21(23,24)22(25,26)27)8-9-16(14)33-20(15,2)3/h5-11H,4,12H2,1-3H3,(H2,28,29,32) |
| InChIKey | TXFUMWPHKZROJV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|