C19H17F3N2O4 — CID 10135235
N-[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(trifluoromethyl)chromen-3-yl]-N-hydroxyacetamide (PubChem CID 10135235) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is N-[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(trifluoromethyl)chromen-3-yl]-N-hydroxyacetamide.
| Compound Name | N-[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(trifluoromethyl)chromen-3-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 10135235 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[2,2-dimethyl-4-(2-oxo-1-pyridinyl)-6-(trifluoromethyl)chromen-3-yl]-N-hydroxyacetamide |
| SMILES | CC(=O)N(O)C1=C(n2ccccc2=O)c2cc(C(F)(F)F)ccc2OC1(C)C |
| InChI | InChI=1S/C19H17F3N2O4/c1-11(25)24(27)17-16(23-9-5-4-6-15(23)26)13-10-12(19(20,21)22)7-8-14(13)28-18(17,2)3/h4-10,27H,1-3H3 |
| InChIKey | GHSMALFHFOEIHB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|