C16H21N3O2 — CID 70526872
3-amino-3-hydroxy-2,2-dimethyl-4-pyrrolidin-1-yl-4H-chromene-6-carbonitrile (PubChem CID 70526872) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-amino-3-hydroxy-2,2-dimethyl-4-pyrrolidin-1-yl-4H-chromene-6-carbonitrile.
| Compound Name | 3-amino-3-hydroxy-2,2-dimethyl-4-pyrrolidin-1-yl-4H-chromene-6-carbonitrile |
|---|---|
| PubChem CID | 70526872 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-amino-3-hydroxy-2,2-dimethyl-4-pyrrolidin-1-yl-4H-chromene-6-carbonitrile |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(N2CCCC2)C1(N)O |
| InChI | InChI=1S/C16H21N3O2/c1-15(2)16(18,20)14(19-7-3-4-8-19)12-9-11(10-17)5-6-13(12)21-15/h5-6,9,14,20H,3-4,7-8,18H2,1-2H3 |
| InChIKey | QARZBTHZVXJSBZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|