C18H16N4O7 — CID 22122745
4-(3,5-dinitro-2-oxo-1-pyridinyl)-3-hydroxy-2,2,3-trimethyl-4H-chromene-6-carbonitrile (PubChem CID 22122745) has the molecular formula C18H16N4O7 and a molecular weight of 400.35 g/mol. Its IUPAC name is 4-(3,5-dinitro-2-oxo-1-pyridinyl)-3-hydroxy-2,2,3-trimethyl-4H-chromene-6-carbonitrile.
| Compound Name | 4-(3,5-dinitro-2-oxo-1-pyridinyl)-3-hydroxy-2,2,3-trimethyl-4H-chromene-6-carbonitrile |
|---|---|
| PubChem CID | 22122745 |
| Molecular Formula | C18H16N4O7 |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | 4-(3,5-dinitro-2-oxo-1-pyridinyl)-3-hydroxy-2,2,3-trimethyl-4H-chromene-6-carbonitrile |
| SMILES | CC1(C)Oc2ccc(C#N)cc2C(n2cc([N+](=O)[O-])cc([N+](=O)[O-])c2=O)C1(C)O |
| InChI | InChI=1S/C18H16N4O7/c1-17(2)18(3,24)15(12-6-10(8-19)4-5-14(12)29-17)20-9-11(21(25)26)7-13(16(20)23)22(27)28/h4-7,9,15,24H,1-3H3 |
| InChIKey | WRYBSMTYSZDXKL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 161.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|