C17H19N3O5 — CID 22122898
3-amino-1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)pyridin-2-one (PubChem CID 22122898) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 3-amino-1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)pyridin-2-one.
| Compound Name | 3-amino-1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)pyridin-2-one |
|---|---|
| PubChem CID | 22122898 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 3-amino-1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)pyridin-2-one |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2C(n2cccc(N)c2=O)C1(C)O |
| InChI | InChI=1S/C17H19N3O5/c1-16(2)17(3,22)14(19-8-4-5-12(18)15(19)21)11-9-10(20(23)24)6-7-13(11)25-16/h4-9,14,22H,18H2,1-3H3 |
| InChIKey | JIMQNHKBFFYRBL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|