C16H18N4O5 — CID 22123079
3-[(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)amino]-1H-pyridazin-6-one (PubChem CID 22123079) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 3-[(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)amino]-1H-pyridazin-6-one.
| Compound Name | 3-[(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)amino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 22123079 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 3-[(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)amino]-1H-pyridazin-6-one |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2C(Nc2ccc(=O)[nH]n2)C1(C)O |
| InChI | InChI=1S/C16H18N4O5/c1-15(2)16(3,22)14(17-12-6-7-13(21)19-18-12)10-8-9(20(23)24)4-5-11(10)25-15/h4-8,14,22H,1-3H3,(H,17,18)(H,19,21) |
| InChIKey | HVUQFSOBTVFQGY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|