C11H11NO5 — CID 87922648
(7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol (PubChem CID 87922648) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol.
| Compound Name | (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol |
|---|---|
| PubChem CID | 87922648 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])ccc2[C@@H]2OC21O |
| InChI | InChI=1S/C11H11NO5/c1-10(2)11(13)9(17-11)7-4-3-6(12(14)15)5-8(7)16-10/h3-5,9,13H,1-2H3/t9-,11?/m0/s1 |
| InChIKey | DWTIRUBTHWHGNQ-FTNKSUMCSA-N |
| XLogP | 1.53 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|