About (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol
(7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol (PubChem CID 87922648) has the molecular formula C11H11NO5
and a molecular weight of 237.21 g/mol. Its IUPAC name is (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol.
Molecular Properties
| Compound Name | (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol |
| PubChem CID | 87922648 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])ccc2[C@@H]2OC21O |
| InChI | InChI=1S/C11H11NO5/c1-10(2)11(13)9(17-11)7-4-3-6(12(14)15)5-8(7)16-10/h3-5,9,13H,1-2H3/t9-,11?/m0/s1 |
| InChIKey | DWTIRUBTHWHGNQ-FTNKSUMCSA-N |
| XLogP | 1.53 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol?
The IUPAC name of (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol (CID 87922648) is (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol.
What is the SMILES notation for (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol?
The canonical SMILES for (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol is CC1(C)Oc2cc([N+](=O)[O-])ccc2[C@@H]2OC21O.
What is the InChIKey of (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol?
The InChIKey is DWTIRUBTHWHGNQ-FTNKSUMCSA-N. The full InChI is InChI=1S/C11H11NO5/c1-10(2)11(13)9(17-11)7-4-3-6(12(14)15)5-8(7)16-10/h3-5,9,13H,1-2H3/t9-,11?/m0/s1.
What are the key properties of (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol?
(7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol has a molecular weight of 237.21 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7bS)-2,2-dimethyl-5-nitro-7bH-oxireno[2,3-c]chromen-1a-ol is sourced from PubChem (CID 87922648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).