C18H18N2O7 — CID 22123148
1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)-2-oxopyridine-3-carboxylic acid (PubChem CID 22123148) has the molecular formula C18H18N2O7 and a molecular weight of 374.35 g/mol. Its IUPAC name is 1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)-2-oxopyridine-3-carboxylic acid.
| Compound Name | 1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)-2-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 22123148 |
| Molecular Formula | C18H18N2O7 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)-2-oxopyridine-3-carboxylic acid |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2C(n2cccc(C(=O)O)c2=O)C1(C)O |
| InChI | InChI=1S/C18H18N2O7/c1-17(2)18(3,24)14(19-8-4-5-11(15(19)21)16(22)23)12-9-10(20(25)26)6-7-13(12)27-17/h4-9,14,24H,1-3H3,(H,22,23) |
| InChIKey | QKLBHNZEXBCESA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 131.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|