C17H16ClN3O7 — CID 22122944
3-chloro-1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)-5-nitropyridin-2-one (PubChem CID 22122944) has the molecular formula C17H16ClN3O7 and a molecular weight of 409.78 g/mol. Its IUPAC name is 3-chloro-1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)-5-nitropyridin-2-one.
| Compound Name | 3-chloro-1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)-5-nitropyridin-2-one |
|---|---|
| PubChem CID | 22122944 |
| Molecular Formula | C17H16ClN3O7 |
| Molecular Weight | 409.78 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 3-chloro-1-(3-hydroxy-2,2,3-trimethyl-6-nitro-4H-chromen-4-yl)-5-nitropyridin-2-one |
| SMILES | CC1(C)Oc2ccc([N+](=O)[O-])cc2C(n2cc([N+](=O)[O-])cc(Cl)c2=O)C1(C)O |
| InChI | InChI=1S/C17H16ClN3O7/c1-16(2)17(3,23)14(11-6-9(20(24)25)4-5-13(11)28-16)19-8-10(21(26)27)7-12(18)15(19)22/h4-8,14,23H,1-3H3 |
| InChIKey | WUTDZWZNVVUZKZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 137.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.78 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|