C14H22O2 — CID 90742078
ethane;2,2,3-trimethyl-3,4-dihydrochromen-4-ol (PubChem CID 90742078) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is ethane;2,2,3-trimethyl-3,4-dihydrochromen-4-ol.
| Compound Name | ethane;2,2,3-trimethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 90742078 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | ethane;2,2,3-trimethyl-3,4-dihydrochromen-4-ol |
| SMILES | CC.CC1C(O)c2ccccc2OC1(C)C |
| InChI | InChI=1S/C12H16O2.C2H6/c1-8-11(13)9-6-4-5-7-10(9)14-12(8,2)3;1-2/h4-8,11,13H,1-3H3;1-2H3 |
| InChIKey | QJEPNPBMQPROOQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |