C17H19NO2 — CID 134962295
(3S,4R)-4-anilino-2,2-dimethyl-3,4-dihydrochromen-3-ol (PubChem CID 134962295) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (3S,4R)-4-anilino-2,2-dimethyl-3,4-dihydrochromen-3-ol.
| Compound Name | (3S,4R)-4-anilino-2,2-dimethyl-3,4-dihydrochromen-3-ol |
|---|---|
| PubChem CID | 134962295 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (3S,4R)-4-anilino-2,2-dimethyl-3,4-dihydrochromen-3-ol |
| SMILES | CC1(C)Oc2ccccc2[C@@H](Nc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C17H19NO2/c1-17(2)16(19)15(18-12-8-4-3-5-9-12)13-10-6-7-11-14(13)20-17/h3-11,15-16,18-19H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | BNOGEMKBBUGSPG-CVEARBPZSA-N |
| XLogP | 3.37 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |