About 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol
3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol (PubChem CID 82187151) has the molecular formula C17H25NO2
and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| PubChem CID | 82187151 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol |
| SMILES | CC1(C)Oc2ccccc2C(O)C1N1CCCCCC1 |
| InChI | InChI=1S/C17H25NO2/c1-17(2)16(18-11-7-3-4-8-12-18)15(19)13-9-5-6-10-14(13)20-17/h5-6,9-10,15-16,19H,3-4,7-8,11-12H2,1-2H3 |
| InChIKey | UBHVAOXCAVGYPG-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The IUPAC name of 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol (CID 82187151) is 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The canonical SMILES for 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol is CC1(C)Oc2ccccc2C(O)C1N1CCCCCC1.
What is the InChIKey of 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
The InChIKey is UBHVAOXCAVGYPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2/c1-17(2)16(18-11-7-3-4-8-12-18)15(19)13-9-5-6-10-14(13)20-17/h5-6,9-10,15-16,19H,3-4,7-8,11-12H2,1-2H3.
What are the key properties of 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol?
3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol has a molecular weight of 275.39 g/mol, XLogP of 3.14, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azepan-1-yl)-2,2-dimethyl-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 82187151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).