About 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol
6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol (PubChem CID 82187460) has the molecular formula C17H25NO4
and a molecular weight of 307.39 g/mol. Its IUPAC name is 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol.
Molecular Properties
| Compound Name | 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol |
| PubChem CID | 82187460 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol |
| SMILES | CCOc1ccc2c(c1)C(O)C(N1CCOCC1)C(C)(C)O2 |
| InChI | InChI=1S/C17H25NO4/c1-4-21-12-5-6-14-13(11-12)15(19)16(17(2,3)22-14)18-7-9-20-10-8-18/h5-6,11,15-16,19H,4,7-10H2,1-3H3 |
| InChIKey | LKDQGTARQXYPTN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol?
The IUPAC name of 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol (CID 82187460) is 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol.
What is the SMILES notation for 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol?
The canonical SMILES for 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol is CCOc1ccc2c(c1)C(O)C(N1CCOCC1)C(C)(C)O2.
What is the InChIKey of 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol?
The InChIKey is LKDQGTARQXYPTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4/c1-4-21-12-5-6-14-13(11-12)15(19)16(17(2,3)22-14)18-7-9-20-10-8-18/h5-6,11,15-16,19H,4,7-10H2,1-3H3.
What are the key properties of 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol?
6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol has a molecular weight of 307.39 g/mol, XLogP of 1.99, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol is sourced from PubChem (CID 82187460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).