C16H23NO4 — CID 82187477
7-methoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol (PubChem CID 82187477) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 7-methoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol.
| Compound Name | 7-methoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 82187477 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 7-methoxy-2,2-dimethyl-3-morpholin-4-yl-3,4-dihydrochromen-4-ol |
| SMILES | COc1ccc2c(c1)OC(C)(C)C(N1CCOCC1)C2O |
| InChI | InChI=1S/C16H23NO4/c1-16(2)15(17-6-8-20-9-7-17)14(18)12-5-4-11(19-3)10-13(12)21-16/h4-5,10,14-15,18H,6-9H2,1-3H3 |
| InChIKey | KQODUYXEQBDXAR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |