C16H22O2 — CID 101012031
(4aS,10bS)-2,2,5,5-tetramethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene (PubChem CID 101012031) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (4aS,10bS)-2,2,5,5-tetramethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene.
| Compound Name | (4aS,10bS)-2,2,5,5-tetramethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 101012031 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (4aS,10bS)-2,2,5,5-tetramethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene |
| SMILES | CC1(C)CC[C@H]2[C@H](O1)c1ccccc1OC2(C)C |
| InChI | InChI=1S/C16H22O2/c1-15(2)10-9-12-14(18-15)11-7-5-6-8-13(11)17-16(12,3)4/h5-8,12,14H,9-10H2,1-4H3/t12-,14+/m0/s1 |
| InChIKey | OVRPUVAHGCNSHZ-GXTWGEPZSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |