C20H28ClNO2 — CID 44658516
dimethyl-[3-(2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromen-2-yl)prop-2-ynyl]azanium chloride (PubChem CID 44658516) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is dimethyl-[3-(2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromen-2-yl)prop-2-ynyl]azanium chloride.
| Compound Name | dimethyl-[3-(2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromen-2-yl)prop-2-ynyl]azanium chloride |
|---|---|
| PubChem CID | 44658516 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | dimethyl-[3-(2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromen-2-yl)prop-2-ynyl]azanium chloride |
| SMILES | C[NH+](C)CC#CC1(C)CCC2C(O1)c1ccccc1OC2(C)C.[Cl-] |
| InChI | InChI=1S/C20H27NO2.ClH/c1-19(2)16-11-13-20(3,12-8-14-21(4)5)23-18(16)15-9-6-7-10-17(15)22-19;/h6-7,9-10,16,18H,11,13-14H2,1-5H3;1H |
| InChIKey | YQXVUHSSRVXYCM-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|