C26H32NO2+ — CID 7077630
3-[(2R,4aR,10bR)-2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromen-2-yl]prop-2-ynyl-benzyl-methylazanium (PubChem CID 7077630) has the molecular formula C26H32NO2+ and a molecular weight of 390.55 g/mol. Its IUPAC name is 3-[(2R,4aR,10bR)-2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromen-2-yl]prop-2-ynyl-benzyl-methylazanium.
| Compound Name | 3-[(2R,4aR,10bR)-2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromen-2-yl]prop-2-ynyl-benzyl-methylazanium |
|---|---|
| PubChem CID | 7077630 |
| Molecular Formula | C26H32NO2+ |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 3-[(2R,4aR,10bR)-2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromen-2-yl]prop-2-ynyl-benzyl-methylazanium |
| SMILES | C[NH+](CC#C[C@@]1(C)CC[C@@H]2[C@@H](O1)c1ccccc1OC2(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO2/c1-25(2)22-15-17-26(3,29-24(22)21-13-8-9-14-23(21)28-25)16-10-18-27(4)19-20-11-6-5-7-12-20/h5-9,11-14,22,24H,15,17-19H2,1-4H3/p+1/t22-,24+,26+/m1/s1 |
| InChIKey | VSJACZVSLVSJHV-CWDLOFLHSA-O |
| XLogP | 3.80 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|