C17H22O2 — CID 2828570
9,16,16-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-triene (PubChem CID 2828570) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 9,16,16-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-triene.
| Compound Name | 9,16,16-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-triene |
|---|---|
| PubChem CID | 2828570 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 9,16,16-trimethyl-8,15-dioxatetracyclo[10.2.2.02,7.09,14]hexadeca-2,4,6-triene |
| SMILES | CC1(C)OC2c3ccccc3OC3(C)CCC1CC23 |
| InChI | InChI=1S/C17H22O2/c1-16(2)11-8-9-17(3)13(10-11)15(19-16)12-6-4-5-7-14(12)18-17/h4-7,11,13,15H,8-10H2,1-3H3 |
| InChIKey | YTVCRPDMRTXKHT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |