C19H24Cl2O2 — CID 163005544
(2R,4aS,10bR)-2-[(1S,3R)-2,2-dichloro-3-methylcyclopropyl]-2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene (PubChem CID 163005544) has the molecular formula C19H24Cl2O2 and a molecular weight of 355.31 g/mol. Its IUPAC name is (2R,4aS,10bR)-2-[(1S,3R)-2,2-dichloro-3-methylcyclopropyl]-2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene.
| Compound Name | (2R,4aS,10bR)-2-[(1S,3R)-2,2-dichloro-3-methylcyclopropyl]-2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 163005544 |
| Molecular Formula | C19H24Cl2O2 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (2R,4aS,10bR)-2-[(1S,3R)-2,2-dichloro-3-methylcyclopropyl]-2,5,5-trimethyl-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene |
| SMILES | C[C@@H]1[C@@H]([C@@]2(C)CC[C@H]3[C@@H](O2)c2ccccc2OC3(C)C)C1(Cl)Cl |
| InChI | InChI=1S/C19H24Cl2O2/c1-11-16(19(11,20)21)18(4)10-9-13-15(23-18)12-7-5-6-8-14(12)22-17(13,2)3/h5-8,11,13,15-16H,9-10H2,1-4H3/t11-,13+,15+,16+,18-/m1/s1 |
| InChIKey | DYGSLTDGTPXLQY-FUDQRUOOSA-N |
| XLogP | 5.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|