C22H30O2 — CID 7375000
(2S,4aR,10bR)-2,5,5-trimethyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene (PubChem CID 7375000) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2S,4aR,10bR)-2,5,5-trimethyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene.
| Compound Name | (2S,4aR,10bR)-2,5,5-trimethyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene |
|---|---|
| PubChem CID | 7375000 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2S,4aR,10bR)-2,5,5-trimethyl-2-[(1S)-4-methylcyclohex-3-en-1-yl]-3,4,4a,10b-tetrahydropyrano[3,2-c]chromene |
| SMILES | CC1=CC[C@@H]([C@]2(C)CC[C@@H]3[C@@H](O2)c2ccccc2OC3(C)C)CC1 |
| InChI | InChI=1S/C22H30O2/c1-15-9-11-16(12-10-15)22(4)14-13-18-20(24-22)17-7-5-6-8-19(17)23-21(18,2)3/h5-9,16,18,20H,10-14H2,1-4H3/t16-,18-,20+,22+/m1/s1 |
| InChIKey | WNJQFPUJKIPERU-MDRHQERFSA-N |
| XLogP | 5.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|