C12H14O2 — CID 10655331
4-deuteriospiro[1,3-benzodioxole-2,1'-cyclohexane] (PubChem CID 10655331) has the molecular formula C12H14O2 and a molecular weight of 191.25 g/mol. Its IUPAC name is 4-deuteriospiro[1,3-benzodioxole-2,1'-cyclohexane].
| Compound Name | 4-deuteriospiro[1,3-benzodioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 10655331 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-deuteriospiro[1,3-benzodioxole-2,1'-cyclohexane] |
| SMILES | [2H]c1cccc2c1OC1(CCCCC1)O2 |
| InChI | InChI=1S/C12H14O2/c1-4-8-12(9-5-1)13-10-6-2-3-7-11(10)14-12/h2-3,6-7H,1,4-5,8-9H2/i6D |
| InChIKey | SPXULWFZNXFRHI-RAMDWTOOSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |