C12H13CuO2 — CID 15970108
copper(1+);spiro[5H-1,3-benzodioxol-5-ide-2,1'-cyclohexane] (PubChem CID 15970108) has the molecular formula C12H13CuO2 and a molecular weight of 252.78 g/mol. Its IUPAC name is copper(1+);spiro[5H-1,3-benzodioxol-5-ide-2,1'-cyclohexane].
| Compound Name | copper(1+);spiro[5H-1,3-benzodioxol-5-ide-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 15970108 |
| Molecular Formula | C12H13CuO2 |
| Molecular Weight | 252.78 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | copper(1+);spiro[5H-1,3-benzodioxol-5-ide-2,1'-cyclohexane] |
| SMILES | [Cu+].[c-]1ccc2c(c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/C12H13O2.Cu/c1-4-8-12(9-5-1)13-10-6-2-3-7-11(10)14-12;/h2,6-7H,1,4-5,8-9H2;/q-1;+1 |
| InChIKey | OSPPSFMONKSUAQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|