C36H39BiO6 — CID 10842932
tri(spiro[1,3-benzodioxole-2,1'-cyclohexane]-4-yl)bismuthane (PubChem CID 10842932) has the molecular formula C36H39BiO6 and a molecular weight of 776.68 g/mol. Its IUPAC name is tri(spiro[1,3-benzodioxole-2,1'-cyclohexane]-4-yl)bismuthane.
| Compound Name | tri(spiro[1,3-benzodioxole-2,1'-cyclohexane]-4-yl)bismuthane |
|---|---|
| PubChem CID | 10842932 |
| Molecular Formula | C36H39BiO6 |
| Molecular Weight | 776.68 g/mol |
| Exact Mass | 776.26 |
| IUPAC Name | tri(spiro[1,3-benzodioxole-2,1'-cyclohexane]-4-yl)bismuthane |
| SMILES | c1cc2c(c([Bi](c3cccc4c3OC3(CCCCC3)O4)c3cccc4c3OC3(CCCCC3)O4)c1)OC1(CCCCC1)O2 |
| InChI | InChI=1S/3C12H13O2.Bi/c3*1-4-8-12(9-5-1)13-10-6-2-3-7-11(10)14-12;/h3*2-3,6H,1,4-5,8-9H2; |
| InChIKey | RVBCSGBAUFYCRA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |