C12H7ClO3S — CID 135059698
2-chlorobenzo[c][2,1]benzoxathiine 6,6-dioxide (PubChem CID 135059698) has the molecular formula C12H7ClO3S and a molecular weight of 266.70 g/mol. Its IUPAC name is 2-chlorobenzo[c][2,1]benzoxathiine 6,6-dioxide.
| Compound Name | 2-chlorobenzo[c][2,1]benzoxathiine 6,6-dioxide |
|---|---|
| PubChem CID | 135059698 |
| Molecular Formula | C12H7ClO3S |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 2-chlorobenzo[c][2,1]benzoxathiine 6,6-dioxide |
| SMILES | O=S1(=O)Oc2ccc(Cl)cc2-c2ccccc21 |
| InChI | InChI=1S/C12H7ClO3S/c13-8-5-6-11-10(7-8)9-3-1-2-4-12(9)17(14,15)16-11/h1-7H |
| InChIKey | SPZDCBNJFBXHET-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|