C15H11ClO4S — CID 56930817
3-[(4-chlorophenyl)methyl]-2,2-dioxo-1,2λ6-benzoxathiin-4-one (PubChem CID 56930817) has the molecular formula C15H11ClO4S and a molecular weight of 322.77 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methyl]-2,2-dioxo-1,2λ6-benzoxathiin-4-one.
| Compound Name | 3-[(4-chlorophenyl)methyl]-2,2-dioxo-1,2λ6-benzoxathiin-4-one |
|---|---|
| PubChem CID | 56930817 |
| Molecular Formula | C15H11ClO4S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 3-[(4-chlorophenyl)methyl]-2,2-dioxo-1,2λ6-benzoxathiin-4-one |
| SMILES | O=C1c2ccccc2OS(=O)(=O)C1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H11ClO4S/c16-11-7-5-10(6-8-11)9-14-15(17)12-3-1-2-4-13(12)20-21(14,18)19/h1-8,14H,9H2 |
| InChIKey | PLIIDDUAJFPHDB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|