C18H13Cl2NO2 — CID 7009477
2-chloro-3-[2-(4-chlorophenyl)ethylimino]naphthalene-1,4-dione (PubChem CID 7009477) has the molecular formula C18H13Cl2NO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is 2-chloro-3-[2-(4-chlorophenyl)ethylimino]naphthalene-1,4-dione.
| Compound Name | 2-chloro-3-[2-(4-chlorophenyl)ethylimino]naphthalene-1,4-dione |
|---|---|
| PubChem CID | 7009477 |
| Molecular Formula | C18H13Cl2NO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2-chloro-3-[2-(4-chlorophenyl)ethylimino]naphthalene-1,4-dione |
| SMILES | O=C1/C(=N/CCc2ccc(Cl)cc2)C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H13Cl2NO2/c19-12-7-5-11(6-8-12)9-10-21-16-15(20)17(22)13-3-1-2-4-14(13)18(16)23/h1-8,15H,9-10H2/b21-16+ |
| InChIKey | RKILCAYOYDJEJD-LTGZKZEYSA-N |
| XLogP | 4.01 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|