C18H14BrClN2O2 — CID 6973041
1-(4-bromophenyl)-3-chloro-4-(2-phenylethylimino)pyrrolidine-2,5-dione (PubChem CID 6973041) has the molecular formula C18H14BrClN2O2 and a molecular weight of 405.68 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-chloro-4-(2-phenylethylimino)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-bromophenyl)-3-chloro-4-(2-phenylethylimino)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6973041 |
| Molecular Formula | C18H14BrClN2O2 |
| Molecular Weight | 405.68 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 1-(4-bromophenyl)-3-chloro-4-(2-phenylethylimino)pyrrolidine-2,5-dione |
| SMILES | O=C1/C(=N/CCc2ccccc2)C(Cl)C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H14BrClN2O2/c19-13-6-8-14(9-7-13)22-17(23)15(20)16(18(22)24)21-11-10-12-4-2-1-3-5-12/h1-9,15H,10-11H2/b21-16+ |
| InChIKey | GDMRHCMNMIOUPE-LTGZKZEYSA-N |
| XLogP | 3.61 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.68 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|