C13H11ClN2O2 — CID 6995900
3-chloro-1-phenyl-4-prop-2-enyliminopyrrolidine-2,5-dione (PubChem CID 6995900) has the molecular formula C13H11ClN2O2 and a molecular weight of 262.70 g/mol. Its IUPAC name is 3-chloro-1-phenyl-4-prop-2-enyliminopyrrolidine-2,5-dione.
| Compound Name | 3-chloro-1-phenyl-4-prop-2-enyliminopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6995900 |
| Molecular Formula | C13H11ClN2O2 |
| Molecular Weight | 262.70 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 3-chloro-1-phenyl-4-prop-2-enyliminopyrrolidine-2,5-dione |
| SMILES | C=CC/N=C1/C(=O)N(c2ccccc2)C(=O)C1Cl |
| InChI | InChI=1S/C13H11ClN2O2/c1-2-8-15-11-10(14)12(17)16(13(11)18)9-6-4-3-5-7-9/h2-7,10H,1,8H2/b15-11+ |
| InChIKey | AZOJYCGPVPDMFM-RVDMUPIBSA-N |
| XLogP | 1.79 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.70 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|