C22H21NO3 — CID 170912665
(4E)-3-but-3-enoxy-4-[(2-methylphenyl)methylidene]-1-phenylpyrrolidine-2,5-dione (PubChem CID 170912665) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is (4E)-3-but-3-enoxy-4-[(2-methylphenyl)methylidene]-1-phenylpyrrolidine-2,5-dione.
| Compound Name | (4E)-3-but-3-enoxy-4-[(2-methylphenyl)methylidene]-1-phenylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 170912665 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (4E)-3-but-3-enoxy-4-[(2-methylphenyl)methylidene]-1-phenylpyrrolidine-2,5-dione |
| SMILES | C=CCCOC1C(=O)N(c2ccccc2)C(=O)/C1=C/c1ccccc1C |
| InChI | InChI=1S/C22H21NO3/c1-3-4-14-26-20-19(15-17-11-9-8-10-16(17)2)21(24)23(22(20)25)18-12-6-5-7-13-18/h3,5-13,15,20H,1,4,14H2,2H3/b19-15+ |
| InChIKey | HAAUIXVNEOZBSS-XDJHFCHBSA-N |
| XLogP | 3.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|