C19H13N2O5- — CID 2289222
4-[(5Z)-5-[(2-methylphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 2289222) has the molecular formula C19H13N2O5- and a molecular weight of 349.32 g/mol. Its IUPAC name is 4-[(5Z)-5-[(2-methylphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | 4-[(5Z)-5-[(2-methylphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 2289222 |
| Molecular Formula | C19H13N2O5- |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-[(5Z)-5-[(2-methylphenyl)methylidene]-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | Cc1ccccc1/C=C1/C(=O)NC(=O)N(c2ccc(C(=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C19H14N2O5/c1-11-4-2-3-5-13(11)10-15-16(22)20-19(26)21(17(15)23)14-8-6-12(7-9-14)18(24)25/h2-10H,1H3,(H,24,25)(H,20,22,26)/p-1/b15-10- |
| InChIKey | JZYMQYJOPYQMMG-GDNBJRDFSA-M |
| XLogP | 1.02 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|