C23H16N2O5 — CID 1339140
methyl 4-[5-(naphthalen-1-ylmethylidene)-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate (PubChem CID 1339140) has the molecular formula C23H16N2O5 and a molecular weight of 400.39 g/mol. Its IUPAC name is methyl 4-[5-(naphthalen-1-ylmethylidene)-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate.
| Compound Name | methyl 4-[5-(naphthalen-1-ylmethylidene)-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
|---|---|
| PubChem CID | 1339140 |
| Molecular Formula | C23H16N2O5 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | methyl 4-[5-(naphthalen-1-ylmethylidene)-2,4,6-trioxo-1,3-diazinan-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)NC(=O)C(=Cc3cccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C23H16N2O5/c1-30-22(28)15-9-11-17(12-10-15)25-21(27)19(20(26)24-23(25)29)13-16-7-4-6-14-5-2-3-8-18(14)16/h2-13H,1H3,(H,24,26,29) |
| InChIKey | WSDYQXIQXKTNMP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|