C19H13N2O7- — CID 2179558
2-[2-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate (PubChem CID 2179558) has the molecular formula C19H13N2O7- and a molecular weight of 381.32 g/mol. Its IUPAC name is 2-[2-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2179558 |
| Molecular Formula | C19H13N2O7- |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 2-[2-[(E)-[1-(4-hydroxyphenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1/C=C1\C(=O)NC(=O)N(c2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C19H14N2O7/c22-13-7-5-12(6-8-13)21-18(26)14(17(25)20-19(21)27)9-11-3-1-2-4-15(11)28-10-16(23)24/h1-9,22H,10H2,(H,23,24)(H,20,25,27)/p-1/b14-9+ |
| InChIKey | VFCBDWMCDHIOSP-NTEUORMPSA-M |
| XLogP | 0.19 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|