C20H15N2O6- — CID 6996879
2-[2-[(1-benzyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate (PubChem CID 6996879) has the molecular formula C20H15N2O6- and a molecular weight of 379.35 g/mol. Its IUPAC name is 2-[2-[(1-benzyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(1-benzyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 6996879 |
| Molecular Formula | C20H15N2O6- |
| Molecular Weight | 379.35 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | 2-[2-[(1-benzyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1C=C1C(=O)NC(=O)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C20H16N2O6/c23-17(24)12-28-16-9-5-4-8-14(16)10-15-18(25)21-20(27)22(19(15)26)11-13-6-2-1-3-7-13/h1-10H,11-12H2,(H,23,24)(H,21,25,27)/p-1 |
| InChIKey | UHLZOSNTPWPXNK-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.35 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|