C12H9N2O4S- — CID 3617867
2-[2-[(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetate (PubChem CID 3617867) has the molecular formula C12H9N2O4S- and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[2-[(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[2-[(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 3617867 |
| Molecular Formula | C12H9N2O4S- |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 2-[2-[(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccccc1C=C1NC(=S)NC1=O |
| InChI | InChI=1S/C12H10N2O4S/c15-10(16)6-18-9-4-2-1-3-7(9)5-8-11(17)14-12(19)13-8/h1-5H,6H2,(H,15,16)(H2,13,14,17,19)/p-1 |
| InChIKey | KKYDQVAGMODEPF-UHFFFAOYSA-M |
| XLogP | -0.84 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|