C19H13N2O5S- — CID 6959250
4-[[2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoate (PubChem CID 6959250) has the molecular formula C19H13N2O5S- and a molecular weight of 381.39 g/mol. Its IUPAC name is 4-[[2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoate.
| Compound Name | 4-[[2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 6959250 |
| Molecular Formula | C19H13N2O5S- |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.06 |
| IUPAC Name | 4-[[2-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-ylidene)methyl]phenoxy]methyl]benzoate |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1ccccc1OCc1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C19H14N2O5S/c22-16-14(17(23)21-19(27)20-16)9-13-3-1-2-4-15(13)26-10-11-5-7-12(8-6-11)18(24)25/h1-9H,10H2,(H,24,25)(H2,20,21,22,23,27)/p-1 |
| InChIKey | ZENKRDIIWCATMM-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|