C22H18N4O4S2 — CID 99902487
(5Z)-5-[[2-[2-[2-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]ethoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 99902487) has the molecular formula C22H18N4O4S2 and a molecular weight of 466.54 g/mol. Its IUPAC name is (5Z)-5-[[2-[2-[2-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]ethoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[2-[2-[2-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]ethoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 99902487 |
| Molecular Formula | C22H18N4O4S2 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.08 |
| IUPAC Name | (5Z)-5-[[2-[2-[2-[(E)-(5-oxo-2-sulfanylideneimidazolidin-4-ylidene)methyl]phenoxy]ethoxy]phenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C\c1ccccc1OCCOc1ccccc1/C=C1/NC(=S)NC1=O |
| InChI | InChI=1S/C22H18N4O4S2/c27-19-15(23-21(31)25-19)11-13-5-1-3-7-17(13)29-9-10-30-18-8-4-2-6-14(18)12-16-20(28)26-22(32)24-16/h1-8,11-12H,9-10H2,(H2,23,25,27,31)(H2,24,26,28,32)/b15-11-,16-12+ |
| InChIKey | BXPYPSAISVRCCF-UKVBVZPVSA-N |
| XLogP | 1.83 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|