C12H10F2N2O3S — CID 7927976
(5Z)-5-[[2-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 7927976) has the molecular formula C12H10F2N2O3S and a molecular weight of 300.29 g/mol. Its IUPAC name is (5Z)-5-[[2-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[2-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 7927976 |
| Molecular Formula | C12H10F2N2O3S |
| Molecular Weight | 300.29 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (5Z)-5-[[2-(difluoromethoxy)-3-methoxyphenyl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cccc(/C=C2\NC(=S)NC2=O)c1OC(F)F |
| InChI | InChI=1S/C12H10F2N2O3S/c1-18-8-4-2-3-6(9(8)19-11(13)14)5-7-10(17)16-12(20)15-7/h2-5,11H,1H3,(H2,15,16,17,20)/b7-5- |
| InChIKey | XLOQJPVDCSGKPM-ALCCZGGFSA-N |
| XLogP | 1.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|