C18H13F3N2O3S — CID 98385018
(5E)-5-[[2-(difluoromethoxy)-3-methoxyphenyl]methylidene]-3-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-one (PubChem CID 98385018) has the molecular formula C18H13F3N2O3S and a molecular weight of 394.37 g/mol. Its IUPAC name is (5E)-5-[[2-(difluoromethoxy)-3-methoxyphenyl]methylidene]-3-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5E)-5-[[2-(difluoromethoxy)-3-methoxyphenyl]methylidene]-3-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 98385018 |
| Molecular Formula | C18H13F3N2O3S |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | (5E)-5-[[2-(difluoromethoxy)-3-methoxyphenyl]methylidene]-3-(2-fluorophenyl)-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cccc(/C=C2/NC(=S)N(c3ccccc3F)C2=O)c1OC(F)F |
| InChI | InChI=1S/C18H13F3N2O3S/c1-25-14-8-4-5-10(15(14)26-17(20)21)9-12-16(24)23(18(27)22-12)13-7-3-2-6-11(13)19/h2-9,17H,1H3,(H,22,27)/b12-9+ |
| InChIKey | HQYVNBYBUFSJJM-FMIVXFBMSA-N |
| XLogP | 3.70 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|