C20H17FN2O3S — CID 46813859
(5Z)-3-(2-fluorophenyl)-5-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 46813859) has the molecular formula C20H17FN2O3S and a molecular weight of 384.43 g/mol. Its IUPAC name is (5Z)-3-(2-fluorophenyl)-5-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-3-(2-fluorophenyl)-5-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 46813859 |
| Molecular Formula | C20H17FN2O3S |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (5Z)-3-(2-fluorophenyl)-5-[(5-methoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | COc1cc2c(cc1/C=C1\NC(=S)N(c3ccccc3F)C1=O)OC(C)C2 |
| InChI | InChI=1S/C20H17FN2O3S/c1-11-7-12-9-17(25-2)13(10-18(12)26-11)8-15-19(24)23(20(27)22-15)16-6-4-3-5-14(16)21/h3-6,8-11H,7H2,1-2H3,(H,22,27)/b15-8- |
| InChIKey | NZVCYNSBQCTHBV-NVNXTCNLSA-N |
| XLogP | 3.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|