C26H22OS — CID 102404590
(2Z,4E)-2,4-bis[(2-methylphenyl)methylidene]-5-phenylthiolan-3-one (PubChem CID 102404590) has the molecular formula C26H22OS and a molecular weight of 382.53 g/mol. Its IUPAC name is (2Z,4E)-2,4-bis[(2-methylphenyl)methylidene]-5-phenylthiolan-3-one.
| Compound Name | (2Z,4E)-2,4-bis[(2-methylphenyl)methylidene]-5-phenylthiolan-3-one |
|---|---|
| PubChem CID | 102404590 |
| Molecular Formula | C26H22OS |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | (2Z,4E)-2,4-bis[(2-methylphenyl)methylidene]-5-phenylthiolan-3-one |
| SMILES | Cc1ccccc1/C=C1\SC(c2ccccc2)/C(=C/c2ccccc2C)C1=O |
| InChI | InChI=1S/C26H22OS/c1-18-10-6-8-14-21(18)16-23-25(27)24(17-22-15-9-7-11-19(22)2)28-26(23)20-12-4-3-5-13-20/h3-17,26H,1-2H3/b23-16+,24-17- |
| InChIKey | JZXDIQXJPIJRQJ-ZNLNQYBNSA-N |
| XLogP | 6.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|