C21H20OS — CID 15567512
(3Z,5Z)-3,5-bis[(2-methylphenyl)methylidene]thian-4-one (PubChem CID 15567512) has the molecular formula C21H20OS and a molecular weight of 320.46 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[(2-methylphenyl)methylidene]thian-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[(2-methylphenyl)methylidene]thian-4-one |
|---|---|
| PubChem CID | 15567512 |
| Molecular Formula | C21H20OS |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (3Z,5Z)-3,5-bis[(2-methylphenyl)methylidene]thian-4-one |
| SMILES | Cc1ccccc1/C=C1\CSC/C(=C\c2ccccc2C)C1=O |
| InChI | InChI=1S/C21H20OS/c1-15-7-3-5-9-17(15)11-19-13-23-14-20(21(19)22)12-18-10-6-4-8-16(18)2/h3-12H,13-14H2,1-2H3/b19-11+,20-12+ |
| InChIKey | SUBKLZGWARKOBF-AYKLPDECSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|