C18H12Cl2OS — CID 2799503
2,4-bis[(2-chlorophenyl)methylidene]thiolan-3-one (PubChem CID 2799503) has the molecular formula C18H12Cl2OS and a molecular weight of 347.27 g/mol. Its IUPAC name is 2,4-bis[(2-chlorophenyl)methylidene]thiolan-3-one.
| Compound Name | 2,4-bis[(2-chlorophenyl)methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 2799503 |
| Molecular Formula | C18H12Cl2OS |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2,4-bis[(2-chlorophenyl)methylidene]thiolan-3-one |
| SMILES | O=C1C(=Cc2ccccc2Cl)CSC1=Cc1ccccc1Cl |
| InChI | InChI=1S/C18H12Cl2OS/c19-15-7-3-1-5-12(15)9-14-11-22-17(18(14)21)10-13-6-2-4-8-16(13)20/h1-10H,11H2 |
| InChIKey | JAUUZNLIXJARRT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|