C19H14Cl2O — CID 20834767
(2Z,5E)-2,5-bis[(2-chlorophenyl)methylidene]cyclopentan-1-one (PubChem CID 20834767) has the molecular formula C19H14Cl2O and a molecular weight of 329.23 g/mol. Its IUPAC name is (2Z,5E)-2,5-bis[(2-chlorophenyl)methylidene]cyclopentan-1-one.
| Compound Name | (2Z,5E)-2,5-bis[(2-chlorophenyl)methylidene]cyclopentan-1-one |
|---|---|
| PubChem CID | 20834767 |
| Molecular Formula | C19H14Cl2O |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | (2Z,5E)-2,5-bis[(2-chlorophenyl)methylidene]cyclopentan-1-one |
| SMILES | O=C1/C(=C\c2ccccc2Cl)CC/C1=C\c1ccccc1Cl |
| InChI | InChI=1S/C19H14Cl2O/c20-17-7-3-1-5-13(17)11-15-9-10-16(19(15)22)12-14-6-2-4-8-18(14)21/h1-8,11-12H,9-10H2/b15-11-,16-12+ |
| InChIKey | RHVDVNSBPYATIJ-UKVBVZPVSA-N |
| XLogP | 5.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|