C26H20Cl2O — CID 24938432
(2E,6E)-2,6-bis[(2-chlorophenyl)methylidene]-4-phenylcyclohexan-1-one (PubChem CID 24938432) has the molecular formula C26H20Cl2O and a molecular weight of 419.35 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(2-chlorophenyl)methylidene]-4-phenylcyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(2-chlorophenyl)methylidene]-4-phenylcyclohexan-1-one |
|---|---|
| PubChem CID | 24938432 |
| Molecular Formula | C26H20Cl2O |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (2E,6E)-2,6-bis[(2-chlorophenyl)methylidene]-4-phenylcyclohexan-1-one |
| SMILES | O=C1/C(=C/c2ccccc2Cl)CC(c2ccccc2)C/C1=C\c1ccccc1Cl |
| InChI | InChI=1S/C26H20Cl2O/c27-24-12-6-4-10-19(24)14-22-16-21(18-8-2-1-3-9-18)17-23(26(22)29)15-20-11-5-7-13-25(20)28/h1-15,21H,16-17H2/b22-14+,23-15+ |
| InChIKey | MDMMHQVBGKVBJU-HOFJZWJUSA-N |
| XLogP | 7.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|