C23H19Cl2NO4 — CID 177480128
4-[(3Z,5E)-3,5-bis[(2-chlorophenyl)methylidene]-4-oxopiperidin-1-yl]-4-oxobutanoic acid (PubChem CID 177480128) has the molecular formula C23H19Cl2NO4 and a molecular weight of 444.31 g/mol. Its IUPAC name is 4-[(3Z,5E)-3,5-bis[(2-chlorophenyl)methylidene]-4-oxopiperidin-1-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(3Z,5E)-3,5-bis[(2-chlorophenyl)methylidene]-4-oxopiperidin-1-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 177480128 |
| Molecular Formula | C23H19Cl2NO4 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 4-[(3Z,5E)-3,5-bis[(2-chlorophenyl)methylidene]-4-oxopiperidin-1-yl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N1C/C(=C/c2ccccc2Cl)C(=O)/C(=C/c2ccccc2Cl)C1 |
| InChI | InChI=1S/C23H19Cl2NO4/c24-19-7-3-1-5-15(19)11-17-13-26(21(27)9-10-22(28)29)14-18(23(17)30)12-16-6-2-4-8-20(16)25/h1-8,11-12H,9-10,13-14H2,(H,28,29)/b17-11-,18-12+ |
| InChIKey | JOWBKOZUSZBKSU-MJZABRMRSA-N |
| XLogP | 4.74 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|