C21H18Cl2O — CID 98105115
(2Z,7Z)-2,7-bis[(2-chlorophenyl)methylidene]cycloheptan-1-one (PubChem CID 98105115) has the molecular formula C21H18Cl2O and a molecular weight of 357.28 g/mol. Its IUPAC name is (2Z,7Z)-2,7-bis[(2-chlorophenyl)methylidene]cycloheptan-1-one.
| Compound Name | (2Z,7Z)-2,7-bis[(2-chlorophenyl)methylidene]cycloheptan-1-one |
|---|---|
| PubChem CID | 98105115 |
| Molecular Formula | C21H18Cl2O |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (2Z,7Z)-2,7-bis[(2-chlorophenyl)methylidene]cycloheptan-1-one |
| SMILES | O=C1/C(=C\c2ccccc2Cl)CCCC/C1=C/c1ccccc1Cl |
| InChI | InChI=1S/C21H18Cl2O/c22-19-11-5-3-7-15(19)13-17-9-1-2-10-18(21(17)24)14-16-8-4-6-12-20(16)23/h3-8,11-14H,1-2,9-10H2/b17-13-,18-14- |
| InChIKey | SHLLNPTZMBSFFR-JTFWXBGUSA-N |
| XLogP | 6.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|