C25H25ClF2N2O2 — CID 163986724
(3E,5E)-3-[(4-chloro-2-fluorophenyl)methylidene]-1-[3-(dimethylamino)propanoyl]-5-[(2-fluoro-4-methylphenyl)methylidene]piperidin-4-one (PubChem CID 163986724) has the molecular formula C25H25ClF2N2O2 and a molecular weight of 458.94 g/mol. Its IUPAC name is (3E,5E)-3-[(4-chloro-2-fluorophenyl)methylidene]-1-[3-(dimethylamino)propanoyl]-5-[(2-fluoro-4-methylphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-3-[(4-chloro-2-fluorophenyl)methylidene]-1-[3-(dimethylamino)propanoyl]-5-[(2-fluoro-4-methylphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 163986724 |
| Molecular Formula | C25H25ClF2N2O2 |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (3E,5E)-3-[(4-chloro-2-fluorophenyl)methylidene]-1-[3-(dimethylamino)propanoyl]-5-[(2-fluoro-4-methylphenyl)methylidene]piperidin-4-one |
| SMILES | Cc1ccc(/C=C2\CN(C(=O)CCN(C)C)C/C(=C\c3ccc(Cl)cc3F)C2=O)c(F)c1 |
| InChI | InChI=1S/C25H25ClF2N2O2/c1-16-4-5-17(22(27)10-16)11-19-14-30(24(31)8-9-29(2)3)15-20(25(19)32)12-18-6-7-21(26)13-23(18)28/h4-7,10-13H,8-9,14-15H2,1-3H3/b19-11+,20-12+ |
| InChIKey | OLIYKOSYHMAJNC-AYKLPDECSA-N |
| XLogP | 4.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|